C17H29NO — CID 115359024
3-[1-(4-butylphenyl)ethylamino]-2,2-dimethylpropan-1-ol (PubChem CID 115359024) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 3-[1-(4-butylphenyl)ethylamino]-2,2-dimethylpropan-1-ol.
| Compound Name | 3-[1-(4-butylphenyl)ethylamino]-2,2-dimethylpropan-1-ol |
|---|---|
| PubChem CID | 115359024 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 3-[1-(4-butylphenyl)ethylamino]-2,2-dimethylpropan-1-ol |
| SMILES | CCCCc1ccc(C(C)NCC(C)(C)CO)cc1 |
| InChI | InChI=1S/C17H29NO/c1-5-6-7-15-8-10-16(11-9-15)14(2)18-12-17(3,4)13-19/h8-11,14,18-19H,5-7,12-13H2,1-4H3 |
| InChIKey | AHICMSOADUOFSK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |