About tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate
tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate (PubChem CID 115359109) has the molecular formula C16H32N2O3
and a molecular weight of 300.44 g/mol. Its IUPAC name is tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate |
| PubChem CID | 115359109 |
| Molecular Formula | C16H32N2O3 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.24 |
| IUPAC Name | tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate |
| SMILES | CC(C)(CO)CNC1CCC(NC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32N2O3/c1-15(2,3)21-14(20)18-13-8-6-12(7-9-13)17-10-16(4,5)11-19/h12-13,17,19H,6-11H2,1-5H3,(H,18,20) |
| InChIKey | FHNSGWHYNOJKPD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate?
The IUPAC name of tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate (CID 115359109) is tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate.
What is the SMILES notation for tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate?
The canonical SMILES for tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate is CC(C)(CO)CNC1CCC(NC(=O)OC(C)(C)C)CC1.
What is the InChIKey of tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate?
The InChIKey is FHNSGWHYNOJKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O3/c1-15(2,3)21-14(20)18-13-8-6-12(7-9-13)17-10-16(4,5)11-19/h12-13,17,19H,6-11H2,1-5H3,(H,18,20).
What are the key properties of tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate?
tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate has a molecular weight of 300.44 g/mol, XLogP of 2.43, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[4-[(3-hydroxy-2,2-dimethylpropyl)amino]cyclohexyl]carbamate is sourced from PubChem (CID 115359109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).