benzyl (2S)-2-cyanopyrrolidine-1-carboxylate

C13H14N2O2 — CID 11535955

IUPACbenzyl (2S)-2-cyanopyrrolidine-1-carboxylate
SMILESN#C[C@@H]1CCCN1C(=O)OCc1ccccc1
InChIInChI=1S/C13H14N2O2/c14-9-12-7-4-8-15(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-8,10H2/t12-/m0/s1
InChIKeyAUVGQGIWVNDVSL-LBPRGKRZSA-N
MW230.27 g/mol
LogP2.31
Rot. Bonds2

About benzyl (2S)-2-cyanopyrrolidine-1-carboxylate

benzyl (2S)-2-cyanopyrrolidine-1-carboxylate (PubChem CID 11535955) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is benzyl (2S)-2-cyanopyrrolidine-1-carboxylate.

Molecular Properties

Compound Namebenzyl (2S)-2-cyanopyrrolidine-1-carboxylate
PubChem CID11535955
Molecular FormulaC13H14N2O2
Molecular Weight230.27 g/mol
Exact Mass230.11
IUPAC Namebenzyl (2S)-2-cyanopyrrolidine-1-carboxylate
SMILESN#C[C@@H]1CCCN1C(=O)OCc1ccccc1
InChIInChI=1S/C13H14N2O2/c14-9-12-7-4-8-15(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-8,10H2/t12-/m0/s1
InChIKeyAUVGQGIWVNDVSL-LBPRGKRZSA-N
XLogP2.31
TPSA53.33 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.27
LogP ≤ 52.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze benzyl (2S)-2-cyanopyrrolidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl (2S)-2-cyanopyrrolidine-1-carboxylate?
The IUPAC name of benzyl (2S)-2-cyanopyrrolidine-1-carboxylate (CID 11535955) is benzyl (2S)-2-cyanopyrrolidine-1-carboxylate.
What is the SMILES notation for benzyl (2S)-2-cyanopyrrolidine-1-carboxylate?
The canonical SMILES for benzyl (2S)-2-cyanopyrrolidine-1-carboxylate is N#C[C@@H]1CCCN1C(=O)OCc1ccccc1.
What is the InChIKey of benzyl (2S)-2-cyanopyrrolidine-1-carboxylate?
The InChIKey is AUVGQGIWVNDVSL-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H14N2O2/c14-9-12-7-4-8-15(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-8,10H2/t12-/m0/s1.
What are the key properties of benzyl (2S)-2-cyanopyrrolidine-1-carboxylate?
benzyl (2S)-2-cyanopyrrolidine-1-carboxylate has a molecular weight of 230.27 g/mol, XLogP of 2.31, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S)-2-cyanopyrrolidine-1-carboxylate is sourced from PubChem (CID 11535955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).