About (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol
(E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol (PubChem CID 11536037) has the molecular formula C14H18F2O
and a molecular weight of 240.29 g/mol. Its IUPAC name is (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol.
Molecular Properties
| Compound Name | (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol |
| PubChem CID | 11536037 |
| Molecular Formula | C14H18F2O |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol |
| SMILES | C/C(=C\C(O)CCc1ccccc1)C(C)(F)F |
| InChI | InChI=1S/C14H18F2O/c1-11(14(2,15)16)10-13(17)9-8-12-6-4-3-5-7-12/h3-7,10,13,17H,8-9H2,1-2H3/b11-10+ |
| InChIKey | AWEOKPOWZXXHHN-ZHACJKMWSA-N |
| XLogP | 3.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol?
The IUPAC name of (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol (CID 11536037) is (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol.
What is the SMILES notation for (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol?
The canonical SMILES for (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol is C/C(=C\C(O)CCc1ccccc1)C(C)(F)F.
What is the InChIKey of (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol?
The InChIKey is AWEOKPOWZXXHHN-ZHACJKMWSA-N. The full InChI is InChI=1S/C14H18F2O/c1-11(14(2,15)16)10-13(17)9-8-12-6-4-3-5-7-12/h3-7,10,13,17H,8-9H2,1-2H3/b11-10+.
What are the key properties of (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol?
(E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol has a molecular weight of 240.29 g/mol, XLogP of 3.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-difluoro-5-methyl-1-phenylhept-4-en-3-ol is sourced from PubChem (CID 11536037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).