About 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide
3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide (PubChem CID 115360877) has the molecular formula C11H17FN2O3S
and a molecular weight of 276.33 g/mol. Its IUPAC name is 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide |
| PubChem CID | 115360877 |
| Molecular Formula | C11H17FN2O3S |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide |
| SMILES | CC(C)(CO)CNc1ccc(S(N)(=O)=O)cc1F |
| InChI | InChI=1S/C11H17FN2O3S/c1-11(2,7-15)6-14-10-4-3-8(5-9(10)12)18(13,16)17/h3-5,14-15H,6-7H2,1-2H3,(H2,13,16,17) |
| InChIKey | QRDAARVWTCMFAG-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide?
The IUPAC name of 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide (CID 115360877) is 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide.
What is the SMILES notation for 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide?
The canonical SMILES for 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide is CC(C)(CO)CNc1ccc(S(N)(=O)=O)cc1F.
What is the InChIKey of 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide?
The InChIKey is QRDAARVWTCMFAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2O3S/c1-11(2,7-15)6-14-10-4-3-8(5-9(10)12)18(13,16)17/h3-5,14-15H,6-7H2,1-2H3,(H2,13,16,17).
What are the key properties of 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide?
3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide has a molecular weight of 276.33 g/mol, XLogP of 0.90, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-[(3-hydroxy-2,2-dimethylpropyl)amino]benzenesulfonamide is sourced from PubChem (CID 115360877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).