C15H24O3 — CID 11536148
(4aS,5S)-5-(methoxymethoxy)-1,1,4a-trimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one (PubChem CID 11536148) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (4aS,5S)-5-(methoxymethoxy)-1,1,4a-trimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one.
| Compound Name | (4aS,5S)-5-(methoxymethoxy)-1,1,4a-trimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one |
|---|---|
| PubChem CID | 11536148 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (4aS,5S)-5-(methoxymethoxy)-1,1,4a-trimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one |
| SMILES | COCO[C@H]1CCC=C2C(C)(C)C(=O)CC[C@@]21C |
| InChI | InChI=1S/C15H24O3/c1-14(2)11-6-5-7-13(18-10-17-4)15(11,3)9-8-12(14)16/h6,13H,5,7-10H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | BRQYDIAXEZBWFU-ZFWWWQNUSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|