About 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine
2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine (PubChem CID 11536158) has the molecular formula C14H20FNO2
and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine |
| PubChem CID | 11536158 |
| Molecular Formula | C14H20FNO2 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine |
| SMILES | COc1ccc(F)cc1C[C@@H]1CC[C@H](CCN)O1 |
| InChI | InChI=1S/C14H20FNO2/c1-17-14-5-2-11(15)8-10(14)9-13-4-3-12(18-13)6-7-16/h2,5,8,12-13H,3-4,6-7,9,16H2,1H3/t12-,13+/m1/s1 |
| InChIKey | PJDWTDSVCNJUGD-OLZOCXBDSA-N |
| XLogP | 2.27 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine?
The IUPAC name of 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine (CID 11536158) is 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine.
What is the SMILES notation for 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine?
The canonical SMILES for 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine is COc1ccc(F)cc1C[C@@H]1CC[C@H](CCN)O1.
What is the InChIKey of 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine?
The InChIKey is PJDWTDSVCNJUGD-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H20FNO2/c1-17-14-5-2-11(15)8-10(14)9-13-4-3-12(18-13)6-7-16/h2,5,8,12-13H,3-4,6-7,9,16H2,1H3/t12-,13+/m1/s1.
What are the key properties of 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine?
2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine has a molecular weight of 253.32 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R,5S)-5-[(5-fluoro-2-methoxyphenyl)methyl]oxolan-2-yl]ethanamine is sourced from PubChem (CID 11536158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).