C15H20BrNO — CID 115361972
8-(3-bromophenyl)-7-oxa-10-azaspiro[4.6]undecane (PubChem CID 115361972) has the molecular formula C15H20BrNO and a molecular weight of 310.23 g/mol. Its IUPAC name is 8-(3-bromophenyl)-7-oxa-10-azaspiro[4.6]undecane.
| Compound Name | 8-(3-bromophenyl)-7-oxa-10-azaspiro[4.6]undecane |
|---|---|
| PubChem CID | 115361972 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 8-(3-bromophenyl)-7-oxa-10-azaspiro[4.6]undecane |
| SMILES | Brc1cccc(C2CNCC3(CCCC3)CO2)c1 |
| InChI | InChI=1S/C15H20BrNO/c16-13-5-3-4-12(8-13)14-9-17-10-15(11-18-14)6-1-2-7-15/h3-5,8,14,17H,1-2,6-7,9-11H2 |
| InChIKey | AVIMLPZLRFTDFJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |