About N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide
N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide (PubChem CID 11536255) has the molecular formula C13H14N2O2S
and a molecular weight of 262.33 g/mol. Its IUPAC name is N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide |
| PubChem CID | 11536255 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide |
| SMILES | N#CCNC(=O)CS(=O)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H14N2O2S/c14-5-6-15-13(16)9-18(17)12-7-10-3-1-2-4-11(10)8-12/h1-4,12H,6-9H2,(H,15,16) |
| InChIKey | XCPONVXEZQLLOU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide?
The IUPAC name of N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide (CID 11536255) is N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide.
What is the SMILES notation for N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide?
The canonical SMILES for N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide is N#CCNC(=O)CS(=O)C1Cc2ccccc2C1.
What is the InChIKey of N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide?
The InChIKey is XCPONVXEZQLLOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2S/c14-5-6-15-13(16)9-18(17)12-7-10-3-1-2-4-11(10)8-12/h1-4,12H,6-9H2,(H,15,16).
What are the key properties of N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide?
N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide has a molecular weight of 262.33 g/mol, XLogP of 0.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-2-(2,3-dihydro-1H-inden-2-ylsulfinyl)acetamide is sourced from PubChem (CID 11536255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).