C15H28O2Si — CID 11536324
tert-butyl-dimethyl-[[(4Z,9E)-3,6,7,8-tetrahydro-2H-oxecin-10-yl]oxy]silane (PubChem CID 11536324) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(4Z,9E)-3,6,7,8-tetrahydro-2H-oxecin-10-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(4Z,9E)-3,6,7,8-tetrahydro-2H-oxecin-10-yl]oxy]silane |
|---|---|
| PubChem CID | 11536324 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(4Z,9E)-3,6,7,8-tetrahydro-2H-oxecin-10-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O/C1=C/CCC/C=C\CCO1 |
| InChI | InChI=1S/C15H28O2Si/c1-15(2,3)18(4,5)17-14-12-10-8-6-7-9-11-13-16-14/h7,9,12H,6,8,10-11,13H2,1-5H3/b9-7-,14-12+ |
| InChIKey | BLAXKWJFPOLXNU-LTPFSSFFSA-N |
| XLogP | 5.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|