C14H30OSi2 — CID 11536348
trimethyl-[(1R,2S)-1-trimethylsilyloxyspiro[2.5]octan-2-yl]silane (PubChem CID 11536348) has the molecular formula C14H30OSi2 and a molecular weight of 270.56 g/mol. Its IUPAC name is trimethyl-[(1R,2S)-1-trimethylsilyloxyspiro[2.5]octan-2-yl]silane.
| Compound Name | trimethyl-[(1R,2S)-1-trimethylsilyloxyspiro[2.5]octan-2-yl]silane |
|---|---|
| PubChem CID | 11536348 |
| Molecular Formula | C14H30OSi2 |
| Molecular Weight | 270.56 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | trimethyl-[(1R,2S)-1-trimethylsilyloxyspiro[2.5]octan-2-yl]silane |
| SMILES | C[Si](C)(C)O[C@H]1[C@@H]([Si](C)(C)C)C12CCCCC2 |
| InChI | InChI=1S/C14H30OSi2/c1-16(2,3)13-12(15-17(4,5)6)14(13)10-8-7-9-11-14/h12-13H,7-11H2,1-6H3/t12-,13+/m0/s1 |
| InChIKey | VUMGLQOFIHZNQA-QWHCGFSZSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|