C12H20ClN3S — CID 115363627
N-[[1-(chloromethyl)cyclopentyl]methyl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine (PubChem CID 115363627) has the molecular formula C12H20ClN3S and a molecular weight of 273.83 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopentyl]methyl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 115363627 |
| Molecular Formula | C12H20ClN3S |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopentyl]methyl]-3-propan-2-yl-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)c1nsc(NCC2(CCl)CCCC2)n1 |
| InChI | InChI=1S/C12H20ClN3S/c1-9(2)10-15-11(17-16-10)14-8-12(7-13)5-3-4-6-12/h9H,3-8H2,1-2H3,(H,14,15,16) |
| InChIKey | WVYANYDSSYRJPI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|