C12H16ClN5O — CID 115363669
7-[[1-(chloromethyl)cyclopentyl]methylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one (PubChem CID 115363669) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is 7-[[1-(chloromethyl)cyclopentyl]methylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one.
| Compound Name | 7-[[1-(chloromethyl)cyclopentyl]methylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
|---|---|
| PubChem CID | 115363669 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 7-[[1-(chloromethyl)cyclopentyl]methylamino]-2H-[1,2,4]triazolo[4,3-c]pyrimidin-3-one |
| SMILES | O=c1[nH]nc2cc(NCC3(CCl)CCCC3)ncn12 |
| InChI | InChI=1S/C12H16ClN5O/c13-6-12(3-1-2-4-12)7-14-9-5-10-16-17-11(19)18(10)8-15-9/h5,8,14H,1-4,6-7H2,(H,17,19) |
| InChIKey | FMKBTHCWIGTRRI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|