C15H22N2O3 — CID 11536434
(E)-1-(3,4-dimethoxyphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine (PubChem CID 11536434) has the molecular formula C15H22N2O3 and a molecular weight of 278.35 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine |
|---|---|
| PubChem CID | 11536434 |
| Molecular Formula | C15H22N2O3 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]methanimine |
| SMILES | COC[C@@H]1CCCN1/N=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O3/c1-18-11-13-5-4-8-17(13)16-10-12-6-7-14(19-2)15(9-12)20-3/h6-7,9-10,13H,4-5,8,11H2,1-3H3/b16-10+/t13-/m0/s1 |
| InChIKey | WEIXOKZISGCFAX-RKPNYOAGSA-N |
| XLogP | 2.15 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|