C13H19ClN2O — CID 115364657
N-(3-chloro-2,2-dimethylpropyl)-2,6-dimethylpyridine-3-carboxamide (PubChem CID 115364657) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylpropyl)-2,6-dimethylpyridine-3-carboxamide.
| Compound Name | N-(3-chloro-2,2-dimethylpropyl)-2,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 115364657 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-(3-chloro-2,2-dimethylpropyl)-2,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ccc(C(=O)NCC(C)(C)CCl)c(C)n1 |
| InChI | InChI=1S/C13H19ClN2O/c1-9-5-6-11(10(2)16-9)12(17)15-8-13(3,4)7-14/h5-6H,7-8H2,1-4H3,(H,15,17) |
| InChIKey | BXEFZVDKCWBXAF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|