C12H14BrClFNO — CID 115364720
2-bromo-N-(3-chloro-2,2-dimethylpropyl)-5-fluorobenzamide (PubChem CID 115364720) has the molecular formula C12H14BrClFNO and a molecular weight of 322.61 g/mol. Its IUPAC name is 2-bromo-N-(3-chloro-2,2-dimethylpropyl)-5-fluorobenzamide.
| Compound Name | 2-bromo-N-(3-chloro-2,2-dimethylpropyl)-5-fluorobenzamide |
|---|---|
| PubChem CID | 115364720 |
| Molecular Formula | C12H14BrClFNO |
| Molecular Weight | 322.61 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 2-bromo-N-(3-chloro-2,2-dimethylpropyl)-5-fluorobenzamide |
| SMILES | CC(C)(CCl)CNC(=O)c1cc(F)ccc1Br |
| InChI | InChI=1S/C12H14BrClFNO/c1-12(2,6-14)7-16-11(17)9-5-8(15)3-4-10(9)13/h3-5H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | FNSGLUKLWABHCX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.61 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|