C15H17BrN2O — CID 115364916
N-(3-bromo-2,2-dimethylpropyl)quinoline-5-carboxamide (PubChem CID 115364916) has the molecular formula C15H17BrN2O and a molecular weight of 321.22 g/mol. Its IUPAC name is N-(3-bromo-2,2-dimethylpropyl)quinoline-5-carboxamide.
| Compound Name | N-(3-bromo-2,2-dimethylpropyl)quinoline-5-carboxamide |
|---|---|
| PubChem CID | 115364916 |
| Molecular Formula | C15H17BrN2O |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | N-(3-bromo-2,2-dimethylpropyl)quinoline-5-carboxamide |
| SMILES | CC(C)(CBr)CNC(=O)c1cccc2ncccc12 |
| InChI | InChI=1S/C15H17BrN2O/c1-15(2,9-16)10-18-14(19)12-5-3-7-13-11(12)6-4-8-17-13/h3-8H,9-10H2,1-2H3,(H,18,19) |
| InChIKey | VUPRZFKKUNYIBZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|