About N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide
N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide (PubChem CID 115365778) has the molecular formula C8H15N5O
and a molecular weight of 197.24 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide |
| PubChem CID | 115365778 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide |
| SMILES | CC(C)(CN)CNC(=O)c1cn[nH]n1 |
| InChI | InChI=1S/C8H15N5O/c1-8(2,4-9)5-10-7(14)6-3-11-13-12-6/h3H,4-5,9H2,1-2H3,(H,10,14)(H,11,12,13) |
| InChIKey | RVNPSEFLSNNQOQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide?
The IUPAC name of N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide (CID 115365778) is N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide.
What is the SMILES notation for N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide?
The canonical SMILES for N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide is CC(C)(CN)CNC(=O)c1cn[nH]n1.
What is the InChIKey of N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide?
The InChIKey is RVNPSEFLSNNQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N5O/c1-8(2,4-9)5-10-7(14)6-3-11-13-12-6/h3H,4-5,9H2,1-2H3,(H,10,14)(H,11,12,13).
What are the key properties of N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide?
N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide has a molecular weight of 197.24 g/mol, XLogP of -0.48, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-amino-2,2-dimethylpropyl)-2H-triazole-4-carboxamide is sourced from PubChem (CID 115365778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).