C18H10S2 — CID 11536607
7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene (PubChem CID 11536607) has the molecular formula C18H10S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene.
| Compound Name | 7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene |
|---|---|
| PubChem CID | 11536607 |
| Molecular Formula | C18H10S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 7,17-dithiapentacyclo[11.7.0.03,11.04,8.014,18]icosa-1,3(11),4(8),5,9,12,14(18),15,19-nonaene |
| SMILES | c1cc2c(ccc3cc4c(ccc5sccc54)cc32)s1 |
| InChI | InChI=1S/C18H10S2/c1-3-17-13(5-7-19-17)15-10-12-2-4-18-14(6-8-20-18)16(12)9-11(1)15/h1-10H |
| InChIKey | SQNSILQPWBRFER-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|