C17H24O4 — CID 11536633
[(1R,2R,7Z,10R,11R)-10-methyl-14-oxo-15-oxatricyclo[9.3.1.02,7]pentadec-7-en-10-yl] acetate (PubChem CID 11536633) has the molecular formula C17H24O4 and a molecular weight of 292.37 g/mol. Its IUPAC name is [(1R,2R,7Z,10R,11R)-10-methyl-14-oxo-15-oxatricyclo[9.3.1.02,7]pentadec-7-en-10-yl] acetate.
| Compound Name | [(1R,2R,7Z,10R,11R)-10-methyl-14-oxo-15-oxatricyclo[9.3.1.02,7]pentadec-7-en-10-yl] acetate |
|---|---|
| PubChem CID | 11536633 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [(1R,2R,7Z,10R,11R)-10-methyl-14-oxo-15-oxatricyclo[9.3.1.02,7]pentadec-7-en-10-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)C/C=C2/CCCC[C@H]2[C@H]2O[C@@H]1CCC2=O |
| InChI | InChI=1S/C17H24O4/c1-11(18)21-17(2)10-9-12-5-3-4-6-13(12)16-14(19)7-8-15(17)20-16/h9,13,15-16H,3-8,10H2,1-2H3/b12-9-/t13-,15-,16-,17-/m1/s1 |
| InChIKey | PDOZNGZIIKVUSL-VLDDUASYSA-N |
| XLogP | 2.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|