C15H13FN2 — CID 115367051
4-(2,5-dimethylanilino)-2-fluorobenzonitrile (PubChem CID 115367051) has the molecular formula C15H13FN2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-(2,5-dimethylanilino)-2-fluorobenzonitrile.
| Compound Name | 4-(2,5-dimethylanilino)-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 115367051 |
| Molecular Formula | C15H13FN2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-(2,5-dimethylanilino)-2-fluorobenzonitrile |
| SMILES | Cc1ccc(C)c(Nc2ccc(C#N)c(F)c2)c1 |
| InChI | InChI=1S/C15H13FN2/c1-10-3-4-11(2)15(7-10)18-13-6-5-12(9-17)14(16)8-13/h3-8,18H,1-2H3 |
| InChIKey | WOMQUNMBECBAGG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |