C16H32O3Si — CID 11536749
(Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloct-6-enal (PubChem CID 11536749) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is (Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloct-6-enal.
| Compound Name | (Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloct-6-enal |
|---|---|
| PubChem CID | 11536749 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (Z,2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-8-hydroxy-2,6-dimethyloct-6-enal |
| SMILES | C/C(=C/CO)CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)C=O |
| InChI | InChI=1S/C16H32O3Si/c1-13(10-11-17)8-9-15(14(2)12-18)19-20(6,7)16(3,4)5/h10,12,14-15,17H,8-9,11H2,1-7H3/b13-10-/t14?,15-/m0/s1 |
| InChIKey | JMNFKTQWQYZZQZ-KYZDOZMGSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|