C13H16FN3O — CID 115367637
2-fluoro-4-[(4-methylmorpholin-2-yl)methylamino]benzonitrile (PubChem CID 115367637) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-fluoro-4-[(4-methylmorpholin-2-yl)methylamino]benzonitrile.
| Compound Name | 2-fluoro-4-[(4-methylmorpholin-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 115367637 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-fluoro-4-[(4-methylmorpholin-2-yl)methylamino]benzonitrile |
| SMILES | CN1CCOC(CNc2ccc(C#N)c(F)c2)C1 |
| InChI | InChI=1S/C13H16FN3O/c1-17-4-5-18-12(9-17)8-16-11-3-2-10(7-15)13(14)6-11/h2-3,6,12,16H,4-5,8-9H2,1H3 |
| InChIKey | SGVUKMGTDSOYAU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |