About (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol
(1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol (PubChem CID 11536788) has the molecular formula C21H21NO
and a molecular weight of 303.41 g/mol. Its IUPAC name is (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol.
Molecular Properties
| Compound Name | (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol |
| PubChem CID | 11536788 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol |
| SMILES | CN(c1ccccc1)[C@@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C21H21NO/c1-22(19-15-9-4-10-16-19)20(17-11-5-2-6-12-17)21(23)18-13-7-3-8-14-18/h2-16,20-21,23H,1H3/t20-,21-/m0/s1 |
| InChIKey | LYCDYVURSXYADR-SFTDATJTSA-N |
| XLogP | 4.60 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol?
The IUPAC name of (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol (CID 11536788) is (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol.
What is the SMILES notation for (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol?
The canonical SMILES for (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol is CN(c1ccccc1)[C@@H](c1ccccc1)[C@@H](O)c1ccccc1.
What is the InChIKey of (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol?
The InChIKey is LYCDYVURSXYADR-SFTDATJTSA-N. The full InChI is InChI=1S/C21H21NO/c1-22(19-15-9-4-10-16-19)20(17-11-5-2-6-12-17)21(23)18-13-7-3-8-14-18/h2-16,20-21,23H,1H3/t20-,21-/m0/s1.
What are the key properties of (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol?
(1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol has a molecular weight of 303.41 g/mol, XLogP of 4.60, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-2-(N-methylanilino)-1,2-diphenylethanol is sourced from PubChem (CID 11536788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).