C15H18FN3OS — CID 115368513
2-fluoro-4-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzenecarbothioamide (PubChem CID 115368513) has the molecular formula C15H18FN3OS and a molecular weight of 307.39 g/mol. Its IUPAC name is 2-fluoro-4-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzenecarbothioamide.
| Compound Name | 2-fluoro-4-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 115368513 |
| Molecular Formula | C15H18FN3OS |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-fluoro-4-(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(N2CCC3NC(=O)CCC3C2)cc1F |
| InChI | InChI=1S/C15H18FN3OS/c16-12-7-10(2-3-11(12)15(17)21)19-6-5-13-9(8-19)1-4-14(20)18-13/h2-3,7,9,13H,1,4-6,8H2,(H2,17,21)(H,18,20) |
| InChIKey | UKVPDKAUTKQXLV-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|