C15H13Br2F2NO — CID 115368993
1-(4-bromo-2,5-difluorophenyl)-1-(4-bromo-2-methoxyphenyl)-N-methylmethanamine (PubChem CID 115368993) has the molecular formula C15H13Br2F2NO and a molecular weight of 421.08 g/mol. Its IUPAC name is 1-(4-bromo-2,5-difluorophenyl)-1-(4-bromo-2-methoxyphenyl)-N-methylmethanamine.
| Compound Name | 1-(4-bromo-2,5-difluorophenyl)-1-(4-bromo-2-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 115368993 |
| Molecular Formula | C15H13Br2F2NO |
| Molecular Weight | 421.08 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | 1-(4-bromo-2,5-difluorophenyl)-1-(4-bromo-2-methoxyphenyl)-N-methylmethanamine |
| SMILES | CNC(c1cc(F)c(Br)cc1F)c1ccc(Br)cc1OC |
| InChI | InChI=1S/C15H13Br2F2NO/c1-20-15(9-4-3-8(16)5-14(9)21-2)10-6-13(19)11(17)7-12(10)18/h3-7,15,20H,1-2H3 |
| InChIKey | UWCJWHNUZUURTH-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.08 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|