C22H26N2 — CID 11537013
4-[(1E,3E,5E)-6-[4-(dimethylamino)phenyl]hexa-1,3,5-trienyl]-N,N-dimethylaniline (PubChem CID 11537013) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4-[(1E,3E,5E)-6-[4-(dimethylamino)phenyl]hexa-1,3,5-trienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E,5E)-6-[4-(dimethylamino)phenyl]hexa-1,3,5-trienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 11537013 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 4-[(1E,3E,5E)-6-[4-(dimethylamino)phenyl]hexa-1,3,5-trienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/C=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H26N2/c1-23(2)21-15-11-19(12-16-21)9-7-5-6-8-10-20-13-17-22(18-14-20)24(3)4/h5-18H,1-4H3/b6-5+,9-7+,10-8+ |
| InChIKey | JGQHLETVKDCCET-NRIIQWGUSA-N |
| XLogP | 5.10 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|