C15H28O7 — CID 11537049
ethyl (2R)-2-[(R)-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-hydroxymethyl]butanoate (PubChem CID 11537049) has the molecular formula C15H28O7 and a molecular weight of 320.38 g/mol. Its IUPAC name is ethyl (2R)-2-[(R)-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-hydroxymethyl]butanoate.
| Compound Name | ethyl (2R)-2-[(R)-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-hydroxymethyl]butanoate |
|---|---|
| PubChem CID | 11537049 |
| Molecular Formula | C15H28O7 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | ethyl (2R)-2-[(R)-[(2S,5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]-hydroxymethyl]butanoate |
| SMILES | CCOC(=O)[C@H](CC)[C@@H](O)[C@@H]1CO[C@@](C)(OC)[C@](C)(OC)O1 |
| InChI | InChI=1S/C15H28O7/c1-7-10(13(17)20-8-2)12(16)11-9-21-14(3,18-5)15(4,19-6)22-11/h10-12,16H,7-9H2,1-6H3/t10-,11+,12-,14-,15-/m1/s1 |
| InChIKey | PJWUXYVDURULFV-BUONHZGMSA-N |
| XLogP | 1.08 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |