About 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one
1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one (PubChem CID 115371014) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one |
| PubChem CID | 115371014 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one |
| SMILES | Cc1cc(C(C)N2CCCNC2=O)c(C)s1 |
| InChI | InChI=1S/C12H18N2OS/c1-8-7-11(10(3)16-8)9(2)14-6-4-5-13-12(14)15/h7,9H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | RNAFXUGQGOHPGM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one?
The IUPAC name of 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one (CID 115371014) is 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one.
What is the SMILES notation for 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one?
The canonical SMILES for 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one is Cc1cc(C(C)N2CCCNC2=O)c(C)s1.
What is the InChIKey of 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one?
The InChIKey is RNAFXUGQGOHPGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2OS/c1-8-7-11(10(3)16-8)9(2)14-6-4-5-13-12(14)15/h7,9H,4-6H2,1-3H3,(H,13,15).
What are the key properties of 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one?
1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one has a molecular weight of 238.36 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(2,5-dimethylthiophen-3-yl)ethyl]-1,3-diazinan-2-one is sourced from PubChem (CID 115371014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).