About 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one
1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one (PubChem CID 115371046) has the molecular formula C11H17N3OS
and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one |
| PubChem CID | 115371046 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one |
| SMILES | CC(C)(C)c1csc(N2CCCNC2=O)n1 |
| InChI | InChI=1S/C11H17N3OS/c1-11(2,3)8-7-16-10(13-8)14-6-4-5-12-9(14)15/h7H,4-6H2,1-3H3,(H,12,15) |
| InChIKey | SFPVQYXLNLYXRC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
The IUPAC name of 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one (CID 115371046) is 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one.
What is the SMILES notation for 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
The canonical SMILES for 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one is CC(C)(C)c1csc(N2CCCNC2=O)n1.
What is the InChIKey of 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
The InChIKey is SFPVQYXLNLYXRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3OS/c1-11(2,3)8-7-16-10(13-8)14-6-4-5-12-9(14)15/h7H,4-6H2,1-3H3,(H,12,15).
What are the key properties of 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one?
1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one has a molecular weight of 239.34 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-tert-butyl-1,3-thiazol-2-yl)-1,3-diazinan-2-one is sourced from PubChem (CID 115371046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).