C9H14N4O — CID 115371101
1-(2-imidazol-1-ylethyl)-1,3-diazinan-2-one (PubChem CID 115371101) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 1-(2-imidazol-1-ylethyl)-1,3-diazinan-2-one.
| Compound Name | 1-(2-imidazol-1-ylethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115371101 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 1-(2-imidazol-1-ylethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CCn1ccnc1 |
| InChI | InChI=1S/C9H14N4O/c14-9-11-2-1-4-13(9)7-6-12-5-3-10-8-12/h3,5,8H,1-2,4,6-7H2,(H,11,14) |
| InChIKey | VZSPHHYYTLCDSN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |