About 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one
1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one (PubChem CID 115371177) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one |
| PubChem CID | 115371177 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one |
| SMILES | CN(CCN1CCCNC1=O)C1CCCC1 |
| InChI | InChI=1S/C12H23N3O/c1-14(11-5-2-3-6-11)9-10-15-8-4-7-13-12(15)16/h11H,2-10H2,1H3,(H,13,16) |
| InChIKey | JGRJSFVPNNDKRD-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one?
The IUPAC name of 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one (CID 115371177) is 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one.
What is the SMILES notation for 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one?
The canonical SMILES for 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one is CN(CCN1CCCNC1=O)C1CCCC1.
What is the InChIKey of 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one?
The InChIKey is JGRJSFVPNNDKRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3O/c1-14(11-5-2-3-6-11)9-10-15-8-4-7-13-12(15)16/h11H,2-10H2,1H3,(H,13,16).
What are the key properties of 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one?
1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one has a molecular weight of 225.34 g/mol, XLogP of 1.28, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[cyclopentyl(methyl)amino]ethyl]-1,3-diazinan-2-one is sourced from PubChem (CID 115371177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).