About ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate
ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate (PubChem CID 115371201) has the molecular formula C10H18N2O3
and a molecular weight of 214.26 g/mol. Its IUPAC name is ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate |
| PubChem CID | 115371201 |
| Molecular Formula | C10H18N2O3 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.13 |
| IUPAC Name | ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate |
| SMILES | CCOC(=O)CCCN1CCCNC1=O |
| InChI | InChI=1S/C10H18N2O3/c1-2-15-9(13)5-3-7-12-8-4-6-11-10(12)14/h2-8H2,1H3,(H,11,14) |
| InChIKey | ITFTTZXUDKOUJN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate?
The IUPAC name of ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate (CID 115371201) is ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate.
What is the SMILES notation for ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate?
The canonical SMILES for ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate is CCOC(=O)CCCN1CCCNC1=O.
What is the InChIKey of ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate?
The InChIKey is ITFTTZXUDKOUJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O3/c1-2-15-9(13)5-3-7-12-8-4-6-11-10(12)14/h2-8H2,1H3,(H,11,14).
What are the key properties of ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate?
ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate has a molecular weight of 214.26 g/mol, XLogP of 0.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-oxo-1,3-diazinan-1-yl)butanoate is sourced from PubChem (CID 115371201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).