C7H9ClIN5 — CID 11537146
6-chloro-7,9-dimethylpurin-9-ium-2-amine iodide (PubChem CID 11537146) has the molecular formula C7H9ClIN5 and a molecular weight of 325.54 g/mol. Its IUPAC name is 6-chloro-7,9-dimethylpurin-9-ium-2-amine iodide.
| Compound Name | 6-chloro-7,9-dimethylpurin-9-ium-2-amine iodide |
|---|---|
| PubChem CID | 11537146 |
| Molecular Formula | C7H9ClIN5 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 6-chloro-7,9-dimethylpurin-9-ium-2-amine iodide |
| SMILES | Cn1c[n+](C)c2nc(N)nc(Cl)c21.[I-] |
| InChI | InChI=1S/C7H9ClN5.HI/c1-12-3-13(2)6-4(12)5(8)10-7(9)11-6;/h3H,1-2H3,(H2,9,10,11);1H/q+1;/p-1 |
| InChIKey | LTWLRNNZYUVBIQ-UHFFFAOYSA-M |
| XLogP | -2.97 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|