C8H12N4O4S — CID 115371508
1-(cyclobutylmethyl)-3-nitropyrazole-4-sulfonamide (PubChem CID 115371508) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-3-nitropyrazole-4-sulfonamide.
| Compound Name | 1-(cyclobutylmethyl)-3-nitropyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115371508 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-(cyclobutylmethyl)-3-nitropyrazole-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cn(CC2CCC2)nc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N4O4S/c9-17(15,16)7-5-11(4-6-2-1-3-6)10-8(7)12(13)14/h5-6H,1-4H2,(H2,9,15,16) |
| InChIKey | WPGRWTMPLPDNSJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 121.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|