C12H8F3NO — CID 115371725
5-[(2,3-difluorophenyl)methoxy]-2-fluoropyridine (PubChem CID 115371725) has the molecular formula C12H8F3NO and a molecular weight of 239.20 g/mol. Its IUPAC name is 5-[(2,3-difluorophenyl)methoxy]-2-fluoropyridine.
| Compound Name | 5-[(2,3-difluorophenyl)methoxy]-2-fluoropyridine |
|---|---|
| PubChem CID | 115371725 |
| Molecular Formula | C12H8F3NO |
| Molecular Weight | 239.20 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-[(2,3-difluorophenyl)methoxy]-2-fluoropyridine |
| SMILES | Fc1ccc(OCc2cccc(F)c2F)cn1 |
| InChI | InChI=1S/C12H8F3NO/c13-10-3-1-2-8(12(10)15)7-17-9-4-5-11(14)16-6-9/h1-6H,7H2 |
| InChIKey | CVOAHZNUIMULRB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.20 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|