About N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine
N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 115372581) has the molecular formula C10H10N4
and a molecular weight of 186.22 g/mol. Its IUPAC name is N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine.
Molecular Properties
| Compound Name | N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine |
| PubChem CID | 115372581 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | C#CCCNc1ccn2nccc2n1 |
| InChI | InChI=1S/C10H10N4/c1-2-3-6-11-9-5-8-14-10(13-9)4-7-12-14/h1,4-5,7-8H,3,6H2,(H,11,13) |
| InChIKey | WZBPAEPISVGRLR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine?
The IUPAC name of N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine (CID 115372581) is N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine.
What is the SMILES notation for N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine?
The canonical SMILES for N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine is C#CCCNc1ccn2nccc2n1.
What is the InChIKey of N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine?
The InChIKey is WZBPAEPISVGRLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4/c1-2-3-6-11-9-5-8-14-10(13-9)4-7-12-14/h1,4-5,7-8H,3,6H2,(H,11,13).
What are the key properties of N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine?
N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine has a molecular weight of 186.22 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-3-ynylpyrazolo[1,5-a]pyrimidin-5-amine is sourced from PubChem (CID 115372581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).