C13H12N4O2 — CID 115372664
5-methoxy-2-pyrazolo[1,5-a]pyrimidin-5-yloxyaniline (PubChem CID 115372664) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 5-methoxy-2-pyrazolo[1,5-a]pyrimidin-5-yloxyaniline.
| Compound Name | 5-methoxy-2-pyrazolo[1,5-a]pyrimidin-5-yloxyaniline |
|---|---|
| PubChem CID | 115372664 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-methoxy-2-pyrazolo[1,5-a]pyrimidin-5-yloxyaniline |
| SMILES | COc1ccc(Oc2ccn3nccc3n2)c(N)c1 |
| InChI | InChI=1S/C13H12N4O2/c1-18-9-2-3-11(10(14)8-9)19-13-5-7-17-12(16-13)4-6-15-17/h2-8H,14H2,1H3 |
| InChIKey | NLHUUQSFTFQQOL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|