About 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine
5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine (PubChem CID 115373016) has the molecular formula C11H14N4O
and a molecular weight of 218.26 g/mol. Its IUPAC name is 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine |
| PubChem CID | 115373016 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine |
| SMILES | c1cc2nc(O[C@H]3CCCNC3)ccn2n1 |
| InChI | InChI=1S/C11H14N4O/c1-2-9(8-12-5-1)16-11-4-7-15-10(14-11)3-6-13-15/h3-4,6-7,9,12H,1-2,5,8H2/t9-/m0/s1 |
| InChIKey | HRZCTLCXMPNSFE-VIFPVBQESA-N |
| XLogP | 0.86 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine?
The IUPAC name of 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine (CID 115373016) is 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine is c1cc2nc(O[C@H]3CCCNC3)ccn2n1.
What is the InChIKey of 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine?
The InChIKey is HRZCTLCXMPNSFE-VIFPVBQESA-N. The full InChI is InChI=1S/C11H14N4O/c1-2-9(8-12-5-1)16-11-4-7-15-10(14-11)3-6-13-15/h3-4,6-7,9,12H,1-2,5,8H2/t9-/m0/s1.
What are the key properties of 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine?
5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine has a molecular weight of 218.26 g/mol, XLogP of 0.86, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3S)-piperidin-3-yl]oxypyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 115373016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).