About 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile
3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile (PubChem CID 115373174) has the molecular formula C9H8N4O
and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile.
Molecular Properties
| Compound Name | 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile |
| PubChem CID | 115373174 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile |
| SMILES | N#CC(CO)c1ccn2nccc2n1 |
| InChI | InChI=1S/C9H8N4O/c10-5-7(6-14)8-2-4-13-9(12-8)1-3-11-13/h1-4,7,14H,6H2 |
| InChIKey | DKXSPOARSQTVQA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 74.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile?
The IUPAC name of 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile (CID 115373174) is 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile.
What is the SMILES notation for 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile?
The canonical SMILES for 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile is N#CC(CO)c1ccn2nccc2n1.
What is the InChIKey of 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile?
The InChIKey is DKXSPOARSQTVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4O/c10-5-7(6-14)8-2-4-13-9(12-8)1-3-11-13/h1-4,7,14H,6H2.
What are the key properties of 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile?
3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile has a molecular weight of 188.19 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-pyrazolo[1,5-a]pyrimidin-5-ylpropanenitrile is sourced from PubChem (CID 115373174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).