C15H24N2O5S — CID 11537492
(2S,3R)-N,3-dihydroxy-2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]butanamide (PubChem CID 11537492) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]butanamide |
|---|---|
| PubChem CID | 11537492 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]butanamide |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc1 |
| InChI | InChI=1S/C15H24N2O5S/c1-5-15(3,4)11-6-8-12(9-7-11)23(21,22)17-13(10(2)18)14(19)16-20/h6-10,13,17-18,20H,5H2,1-4H3,(H,16,19)/t10-,13+/m1/s1 |
| InChIKey | LLGSUFDGKWYCSV-MFKMUULPSA-N |
| XLogP | 0.91 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|