C16H26N2 — CID 115375664
N-[[2-(5-methyl-3-pyridinyl)cyclohexyl]methyl]propan-1-amine (PubChem CID 115375664) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[[2-(5-methyl-3-pyridinyl)cyclohexyl]methyl]propan-1-amine.
| Compound Name | N-[[2-(5-methyl-3-pyridinyl)cyclohexyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 115375664 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[[2-(5-methyl-3-pyridinyl)cyclohexyl]methyl]propan-1-amine |
| SMILES | CCCNCC1CCCCC1c1cncc(C)c1 |
| InChI | InChI=1S/C16H26N2/c1-3-8-17-11-14-6-4-5-7-16(14)15-9-13(2)10-18-12-15/h9-10,12,14,16-17H,3-8,11H2,1-2H3 |
| InChIKey | AGGRQPAFGMPGPU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|