About 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid
2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid (PubChem CID 11537570) has the molecular formula C20H19N3O3
and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| PubChem CID | 11537570 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid |
| SMILES | O=C(O)Cn1c2c(c3ccccc31)CN(C(=O)Nc1ccccc1)CC2 |
| InChI | InChI=1S/C20H19N3O3/c24-19(25)13-23-17-9-5-4-8-15(17)16-12-22(11-10-18(16)23)20(26)21-14-6-2-1-3-7-14/h1-9H,10-13H2,(H,21,26)(H,24,25) |
| InChIKey | PUZHLYRRBZSLLV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The IUPAC name of 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid (CID 11537570) is 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid.
What is the SMILES notation for 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The canonical SMILES for 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid is O=C(O)Cn1c2c(c3ccccc31)CN(C(=O)Nc1ccccc1)CC2.
What is the InChIKey of 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
The InChIKey is PUZHLYRRBZSLLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19N3O3/c24-19(25)13-23-17-9-5-4-8-15(17)16-12-22(11-10-18(16)23)20(26)21-14-6-2-1-3-7-14/h1-9H,10-13H2,(H,21,26)(H,24,25).
What are the key properties of 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid?
2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid has a molecular weight of 349.39 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(phenylcarbamoyl)-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl]acetic acid is sourced from PubChem (CID 11537570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).