C14H10F5NO4 — CID 11537611
(2,3,4,5,6-pentafluorophenyl) 2-methyl-2-(prop-2-ynoxycarbonylamino)propanoate (PubChem CID 11537611) has the molecular formula C14H10F5NO4 and a molecular weight of 351.23 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-methyl-2-(prop-2-ynoxycarbonylamino)propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-methyl-2-(prop-2-ynoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 11537611 |
| Molecular Formula | C14H10F5NO4 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-methyl-2-(prop-2-ynoxycarbonylamino)propanoate |
| SMILES | C#CCOC(=O)NC(C)(C)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H10F5NO4/c1-4-5-23-13(22)20-14(2,3)12(21)24-11-9(18)7(16)6(15)8(17)10(11)19/h1H,5H2,2-3H3,(H,20,22) |
| InChIKey | CYJGENKIIQNSFL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|