C15H23N3O3 — CID 115378513
3-[[3-(dimethylamino)phenyl]carbamoyl-ethylamino]butanoic acid (PubChem CID 115378513) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-[[3-(dimethylamino)phenyl]carbamoyl-ethylamino]butanoic acid.
| Compound Name | 3-[[3-(dimethylamino)phenyl]carbamoyl-ethylamino]butanoic acid |
|---|---|
| PubChem CID | 115378513 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 3-[[3-(dimethylamino)phenyl]carbamoyl-ethylamino]butanoic acid |
| SMILES | CCN(C(=O)Nc1cccc(N(C)C)c1)C(C)CC(=O)O |
| InChI | InChI=1S/C15H23N3O3/c1-5-18(11(2)9-14(19)20)15(21)16-12-7-6-8-13(10-12)17(3)4/h6-8,10-11H,5,9H2,1-4H3,(H,16,21)(H,19,20) |
| InChIKey | JWUHMFWAFLZPQK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |