C14H13F4N3 — CID 115378878
3-N,3-N,4-trimethyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzene-1,3-diamine (PubChem CID 115378878) has the molecular formula C14H13F4N3 and a molecular weight of 299.27 g/mol. Its IUPAC name is 3-N,3-N,4-trimethyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzene-1,3-diamine.
| Compound Name | 3-N,3-N,4-trimethyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 115378878 |
| Molecular Formula | C14H13F4N3 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-N,3-N,4-trimethyl-1-N-(2,3,5,6-tetrafluoro-4-pyridinyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(Nc2c(F)c(F)nc(F)c2F)cc1N(C)C |
| InChI | InChI=1S/C14H13F4N3/c1-7-4-5-8(6-9(7)21(2)3)19-12-10(15)13(17)20-14(18)11(12)16/h4-6H,1-3H3,(H,19,20) |
| InChIKey | RESFTLKAERSFHO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|