C11H15N5S — CID 115379204
3-amino-4-[3-(dimethylamino)-4-methylphenyl]-1H-1,2,4-triazole-5-thione (PubChem CID 115379204) has the molecular formula C11H15N5S and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-amino-4-[3-(dimethylamino)-4-methylphenyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-[3-(dimethylamino)-4-methylphenyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 115379204 |
| Molecular Formula | C11H15N5S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-amino-4-[3-(dimethylamino)-4-methylphenyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(N)n[nH]c2=S)cc1N(C)C |
| InChI | InChI=1S/C11H15N5S/c1-7-4-5-8(6-9(7)15(2)3)16-10(12)13-14-11(16)17/h4-6H,1-3H3,(H2,12,13)(H,14,17) |
| InChIKey | NFZBWHBFACVWKF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|