C17H24N4 — CID 115379224
5-(2-ethyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)-N,N,2-trimethylaniline (PubChem CID 115379224) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is 5-(2-ethyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)-N,N,2-trimethylaniline.
| Compound Name | 5-(2-ethyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 115379224 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | 5-(2-ethyl-4,5,6,7-tetrahydroimidazo[4,5-c]pyridin-1-yl)-N,N,2-trimethylaniline |
| SMILES | CCc1nc2c(n1-c1ccc(C)c(N(C)C)c1)CCNC2 |
| InChI | InChI=1S/C17H24N4/c1-5-17-19-14-11-18-9-8-15(14)21(17)13-7-6-12(2)16(10-13)20(3)4/h6-7,10,18H,5,8-9,11H2,1-4H3 |
| InChIKey | LTMQOASDTZNVGG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |