C17H29N3 — CID 115379254
3-(2-ethyl-5-propylpiperazin-1-yl)-N,N-dimethylaniline (PubChem CID 115379254) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is 3-(2-ethyl-5-propylpiperazin-1-yl)-N,N-dimethylaniline.
| Compound Name | 3-(2-ethyl-5-propylpiperazin-1-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115379254 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | 3-(2-ethyl-5-propylpiperazin-1-yl)-N,N-dimethylaniline |
| SMILES | CCCC1CN(c2cccc(N(C)C)c2)C(CC)CN1 |
| InChI | InChI=1S/C17H29N3/c1-5-8-14-13-20(15(6-2)12-18-14)17-10-7-9-16(11-17)19(3)4/h7,9-11,14-15,18H,5-6,8,12-13H2,1-4H3 |
| InChIKey | XUQFAGAKGNPSPQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |