About 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline
3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline (PubChem CID 115379292) has the molecular formula C17H27N3
and a molecular weight of 273.42 g/mol. Its IUPAC name is 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline |
| PubChem CID | 115379292 |
| Molecular Formula | C17H27N3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.22 |
| IUPAC Name | 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(N2CCCNC(C)(C3CC3)C2)c1 |
| InChI | InChI=1S/C17H27N3/c1-17(14-8-9-14)13-20(11-5-10-18-17)16-7-4-6-15(12-16)19(2)3/h4,6-7,12,14,18H,5,8-11,13H2,1-3H3 |
| InChIKey | WGGLTPQJLXRMLJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline?
The IUPAC name of 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline (CID 115379292) is 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline.
What is the SMILES notation for 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline?
The canonical SMILES for 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline is CN(C)c1cccc(N2CCCNC(C)(C3CC3)C2)c1.
What is the InChIKey of 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline?
The InChIKey is WGGLTPQJLXRMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3/c1-17(14-8-9-14)13-20(11-5-10-18-17)16-7-4-6-15(12-16)19(2)3/h4,6-7,12,14,18H,5,8-11,13H2,1-3H3.
What are the key properties of 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline?
3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline has a molecular weight of 273.42 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyclopropyl-3-methyl-1,4-diazepan-1-yl)-N,N-dimethylaniline is sourced from PubChem (CID 115379292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).